![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Logic and Computer Design Fundamentals.pdf | 2019-03-07 13:36 | 67M | |
| Engineering Digital Design 2e.pdf | 2019-03-07 13:35 | 63M | |
| RTL Hardware Design using VHDL.pdf | 2019-03-07 13:36 | 34M | |
| Fundamentals of Digital Logic With VHDL Design.pdf | 2019-03-07 13:35 | 33M | |
| VLSI Physical Design.pdf | 2019-03-07 17:34 | 24M | |
| Digital Systems and Applications 2e.pdf | 2019-03-07 13:35 | 18M | |
| Digital Design and Fabrication.pdf | 2019-03-07 13:34 | 18M | |
| Digital Electronics Demystified (2004).pdf | 2019-03-07 17:24 | 14M | |
| VHDL - Coding Styles and Methodologies.pdf | 2019-03-07 13:36 | 12M | |
| Digital Design.pdf | 2019-03-07 13:34 | 12M | |
| Verilog - A Guide to Digital Design and Synthesis.pdf | 2019-03-07 13:36 | 8.8M | |
| Digital Design with CPLD Applications and VHDL.pdf | 2019-03-07 13:34 | 8.6M | |
| Digital Design Principles And Practices.pdf | 2019-03-07 13:34 | 8.1M | |
| Complete Digital Design.pdf | 2019-03-07 13:34 | 5.7M | |
![[ ]](/icons/unknown.gif) | Digital Logic and Microprocessor Design With VHDLpdf | 2019-03-07 13:34 | 4.8M | |
| The Design Warriors Guide to FPGAs.pdf | 2019-03-07 13:36 | 4.5M | |
| ASIC and FPGA Verification - A Guide To Component Modeling.pdf | 2019-03-07 13:34 | 3.1M | |
| Digital Electronics.pdf | 2019-03-07 13:34 | 2.7M | |
| VHDL Programming by Example.pdf | 2019-03-07 13:36 | 2.3M | |
| Digital Design Principles And Practices Solutions.pdf | 2019-03-07 13:34 | 638K | |
| VHDL Cookbook.pdf | 2019-03-07 17:34 | 298K | |
|
|---|